About 2-pent-4-enoyloxyethyl pent-4-enoate
2-pent-4-enoyloxyethyl pent-4-enoate (PubChem CID 23466493) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is 2-pent-4-enoyloxyethyl pent-4-enoate.
Molecular Properties
| Compound Name | 2-pent-4-enoyloxyethyl pent-4-enoate |
| PubChem CID | 23466493 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 2-pent-4-enoyloxyethyl pent-4-enoate |
| SMILES | C=CCCC(=O)OCCOC(=O)CCC=C |
| InChI | InChI=1S/C12H18O4/c1-3-5-7-11(13)15-9-10-16-12(14)8-6-4-2/h3-4H,1-2,5-10H2 |
| InChIKey | ZKORETKTFGKMKZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-4-enoyloxyethyl pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-4-enoyloxyethyl pent-4-enoate?
The IUPAC name of 2-pent-4-enoyloxyethyl pent-4-enoate (CID 23466493) is 2-pent-4-enoyloxyethyl pent-4-enoate.
What is the SMILES notation for 2-pent-4-enoyloxyethyl pent-4-enoate?
The canonical SMILES for 2-pent-4-enoyloxyethyl pent-4-enoate is C=CCCC(=O)OCCOC(=O)CCC=C.
What is the InChIKey of 2-pent-4-enoyloxyethyl pent-4-enoate?
The InChIKey is ZKORETKTFGKMKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-3-5-7-11(13)15-9-10-16-12(14)8-6-4-2/h3-4H,1-2,5-10H2.
What are the key properties of 2-pent-4-enoyloxyethyl pent-4-enoate?
2-pent-4-enoyloxyethyl pent-4-enoate has a molecular weight of 226.27 g/mol, XLogP of 2.01, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-4-enoyloxyethyl pent-4-enoate is sourced from PubChem (CID 23466493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).