About 2-but-3-enyl-2,6-dimethyl-1H-pyridine
2-but-3-enyl-2,6-dimethyl-1H-pyridine (PubChem CID 23466599) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 2-but-3-enyl-2,6-dimethyl-1H-pyridine.
Molecular Properties
| Compound Name | 2-but-3-enyl-2,6-dimethyl-1H-pyridine |
| PubChem CID | 23466599 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 2-but-3-enyl-2,6-dimethyl-1H-pyridine |
| SMILES | C=CCCC1(C)C=CC=C(C)N1 |
| InChI | InChI=1S/C11H17N/c1-4-5-8-11(3)9-6-7-10(2)12-11/h4,6-7,9,12H,1,5,8H2,2-3H3 |
| InChIKey | SDEUDTSIPMYIFG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-enyl-2,6-dimethyl-1H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-enyl-2,6-dimethyl-1H-pyridine?
The IUPAC name of 2-but-3-enyl-2,6-dimethyl-1H-pyridine (CID 23466599) is 2-but-3-enyl-2,6-dimethyl-1H-pyridine.
What is the SMILES notation for 2-but-3-enyl-2,6-dimethyl-1H-pyridine?
The canonical SMILES for 2-but-3-enyl-2,6-dimethyl-1H-pyridine is C=CCCC1(C)C=CC=C(C)N1.
What is the InChIKey of 2-but-3-enyl-2,6-dimethyl-1H-pyridine?
The InChIKey is SDEUDTSIPMYIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-4-5-8-11(3)9-6-7-10(2)12-11/h4,6-7,9,12H,1,5,8H2,2-3H3.
What are the key properties of 2-but-3-enyl-2,6-dimethyl-1H-pyridine?
2-but-3-enyl-2,6-dimethyl-1H-pyridine has a molecular weight of 163.26 g/mol, XLogP of 2.77, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-enyl-2,6-dimethyl-1H-pyridine is sourced from PubChem (CID 23466599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).