About but-3-enylthiourea
but-3-enylthiourea (PubChem CID 23466603) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is but-3-enylthiourea.
Molecular Properties
| Compound Name | but-3-enylthiourea |
| PubChem CID | 23466603 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | but-3-enylthiourea |
| SMILES | C=CCCNC(N)=S |
| InChI | InChI=1S/C5H10N2S/c1-2-3-4-7-5(6)8/h2H,1,3-4H2,(H3,6,7,8) |
| InChIKey | KCISBBLCEUVIOT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze but-3-enylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enylthiourea?
The IUPAC name of but-3-enylthiourea (CID 23466603) is but-3-enylthiourea.
What is the SMILES notation for but-3-enylthiourea?
The canonical SMILES for but-3-enylthiourea is C=CCCNC(N)=S.
What is the InChIKey of but-3-enylthiourea?
The InChIKey is KCISBBLCEUVIOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2S/c1-2-3-4-7-5(6)8/h2H,1,3-4H2,(H3,6,7,8).
What are the key properties of but-3-enylthiourea?
but-3-enylthiourea has a molecular weight of 130.22 g/mol, XLogP of 0.40, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enylthiourea is sourced from PubChem (CID 23466603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).