About 3-but-3-enyl-1,1-dibutylurea
3-but-3-enyl-1,1-dibutylurea (PubChem CID 23466617) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 3-but-3-enyl-1,1-dibutylurea.
Molecular Properties
| Compound Name | 3-but-3-enyl-1,1-dibutylurea |
| PubChem CID | 23466617 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 3-but-3-enyl-1,1-dibutylurea |
| SMILES | C=CCCNC(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C13H26N2O/c1-4-7-10-14-13(16)15(11-8-5-2)12-9-6-3/h4H,1,5-12H2,2-3H3,(H,14,16) |
| InChIKey | DIJGUAYLQZUBTF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-1,1-dibutylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-1,1-dibutylurea?
The IUPAC name of 3-but-3-enyl-1,1-dibutylurea (CID 23466617) is 3-but-3-enyl-1,1-dibutylurea.
What is the SMILES notation for 3-but-3-enyl-1,1-dibutylurea?
The canonical SMILES for 3-but-3-enyl-1,1-dibutylurea is C=CCCNC(=O)N(CCCC)CCCC.
What is the InChIKey of 3-but-3-enyl-1,1-dibutylurea?
The InChIKey is DIJGUAYLQZUBTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-4-7-10-14-13(16)15(11-8-5-2)12-9-6-3/h4H,1,5-12H2,2-3H3,(H,14,16).
What are the key properties of 3-but-3-enyl-1,1-dibutylurea?
3-but-3-enyl-1,1-dibutylurea has a molecular weight of 226.36 g/mol, XLogP of 3.17, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-1,1-dibutylurea is sourced from PubChem (CID 23466617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).