About 2-piperazin-1-yl-1,3-thiazole;hydrochloride
2-piperazin-1-yl-1,3-thiazole;hydrochloride (PubChem CID 23467106) has the molecular formula C7H12ClN3S
and a molecular weight of 205.71 g/mol. Its IUPAC name is 2-piperazin-1-yl-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-piperazin-1-yl-1,3-thiazole;hydrochloride |
| PubChem CID | 23467106 |
| Molecular Formula | C7H12ClN3S |
| Molecular Weight | 205.71 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 2-piperazin-1-yl-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1csc(N2CCNCC2)n1 |
| InChI | InChI=1S/C7H11N3S.ClH/c1-4-10(5-2-8-1)7-9-3-6-11-7;/h3,6,8H,1-2,4-5H2;1H |
| InChIKey | BIHQYKGSYPXHRN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-piperazin-1-yl-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-yl-1,3-thiazole;hydrochloride?
The IUPAC name of 2-piperazin-1-yl-1,3-thiazole;hydrochloride (CID 23467106) is 2-piperazin-1-yl-1,3-thiazole;hydrochloride.
What is the SMILES notation for 2-piperazin-1-yl-1,3-thiazole;hydrochloride?
The canonical SMILES for 2-piperazin-1-yl-1,3-thiazole;hydrochloride is Cl.c1csc(N2CCNCC2)n1.
What is the InChIKey of 2-piperazin-1-yl-1,3-thiazole;hydrochloride?
The InChIKey is BIHQYKGSYPXHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3S.ClH/c1-4-10(5-2-8-1)7-9-3-6-11-7;/h3,6,8H,1-2,4-5H2;1H.
What are the key properties of 2-piperazin-1-yl-1,3-thiazole;hydrochloride?
2-piperazin-1-yl-1,3-thiazole;hydrochloride has a molecular weight of 205.71 g/mol, XLogP of 0.97, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-yl-1,3-thiazole;hydrochloride is sourced from PubChem (CID 23467106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).