About (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol
(1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol (PubChem CID 23467304) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol.
Molecular Properties
| Compound Name | (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol |
| PubChem CID | 23467304 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol |
| SMILES | CC1CN(C)C(CO)=N1 |
| InChI | InChI=1S/C6H12N2O/c1-5-3-8(2)6(4-9)7-5/h5,9H,3-4H2,1-2H3 |
| InChIKey | TYXRVXHRRCMZIJ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol?
The IUPAC name of (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol (CID 23467304) is (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol.
What is the SMILES notation for (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol?
The canonical SMILES for (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol is CC1CN(C)C(CO)=N1.
What is the InChIKey of (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol?
The InChIKey is TYXRVXHRRCMZIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-5-3-8(2)6(4-9)7-5/h5,9H,3-4H2,1-2H3.
What are the key properties of (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol?
(1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol has a molecular weight of 128.17 g/mol, XLogP of -0.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dimethyl-4,5-dihydroimidazol-2-yl)methanol is sourced from PubChem (CID 23467304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).