C18H34N6 — CID 23467435
bis[2-methyl-1-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)propyl]diazene (PubChem CID 23467435) has the molecular formula C18H34N6 and a molecular weight of 334.51 g/mol. Its IUPAC name is bis[2-methyl-1-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)propyl]diazene.
| Compound Name | bis[2-methyl-1-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)propyl]diazene |
|---|---|
| PubChem CID | 23467435 |
| Molecular Formula | C18H34N6 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.28 |
| IUPAC Name | bis[2-methyl-1-(4,5,6,7-tetrahydro-1H-1,3-diazepin-2-yl)propyl]diazene |
| SMILES | CC(C)C(/N=N/C(C1=NCCCCN1)C(C)C)C1=NCCCCN1 |
| InChI | InChI=1S/C18H34N6/c1-13(2)15(17-19-9-5-6-10-20-17)23-24-16(14(3)4)18-21-11-7-8-12-22-18/h13-16H,5-12H2,1-4H3,(H,19,20)(H,21,22)/b24-23+ |
| InChIKey | USAHRGUSDXRZSL-WCWDXBQESA-N |
| XLogP | 3.05 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|