C9H12N2O — CID 23467541
2-methoxy-3,5-dimethylcyclohexa-2,5-diene-1,4-diimine (PubChem CID 23467541) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-methoxy-3,5-dimethylcyclohexa-2,5-diene-1,4-diimine.
| Compound Name | 2-methoxy-3,5-dimethylcyclohexa-2,5-diene-1,4-diimine |
|---|---|
| PubChem CID | 23467541 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 2-methoxy-3,5-dimethylcyclohexa-2,5-diene-1,4-diimine |
| SMILES | [H]/N=C1\C=C(C)/C(=N\[H])C(C)=C1OC |
| InChI | InChI=1S/C9H12N2O/c1-5-4-7(10)9(12-3)6(2)8(5)11/h4,10-11H,1-3H3/b10-7+,11-8+ |
| InChIKey | YPSHNFKRABPGLS-AMMQDNIMSA-N |
| XLogP | 1.91 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|