About 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine
2-pyrimidin-2-yl-1,7-naphthyridin-8-amine (PubChem CID 23467675) has the molecular formula C12H9N5
and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine.
Molecular Properties
| Compound Name | 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine |
| PubChem CID | 23467675 |
| Molecular Formula | C12H9N5 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine |
| SMILES | Nc1nccc2ccc(-c3ncccn3)nc12 |
| InChI | InChI=1S/C12H9N5/c13-11-10-8(4-7-14-11)2-3-9(17-10)12-15-5-1-6-16-12/h1-7H,(H2,13,14) |
| InChIKey | AVGJGMHNPZPQCD-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine?
The IUPAC name of 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine (CID 23467675) is 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine.
What is the SMILES notation for 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine?
The canonical SMILES for 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine is Nc1nccc2ccc(-c3ncccn3)nc12.
What is the InChIKey of 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine?
The InChIKey is AVGJGMHNPZPQCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N5/c13-11-10-8(4-7-14-11)2-3-9(17-10)12-15-5-1-6-16-12/h1-7H,(H2,13,14).
What are the key properties of 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine?
2-pyrimidin-2-yl-1,7-naphthyridin-8-amine has a molecular weight of 223.24 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-2-yl-1,7-naphthyridin-8-amine is sourced from PubChem (CID 23467675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).