C32H53N3O6 — CID 23467796
3-[3-[bis(2,3-dihydroxypropyl)amino]propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol (PubChem CID 23467796) has the molecular formula C32H53N3O6 and a molecular weight of 575.79 g/mol. Its IUPAC name is 3-[3-[bis(2,3-dihydroxypropyl)amino]propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol.
| Compound Name | 3-[3-[bis(2,3-dihydroxypropyl)amino]propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 23467796 |
| Molecular Formula | C32H53N3O6 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.39 |
| IUPAC Name | 3-[3-[bis(2,3-dihydroxypropyl)amino]propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol |
| SMILES | OCC(O)CN(CCCNC(CCc1ccccc1)CCc1ccccc1)CCCN(CC(O)CO)CC(O)CO |
| InChI | InChI=1S/C32H53N3O6/c36-24-30(39)21-34(19-8-20-35(22-31(40)25-37)23-32(41)26-38)18-7-17-33-29(15-13-27-9-3-1-4-10-27)16-14-28-11-5-2-6-12-28/h1-6,9-12,29-33,36-41H,7-8,13-26H2 |
| InChIKey | PKYRFVKMKWGVET-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|