C29H47N3O4 — CID 23467799
3-[3-(1,3-dihydroxypropan-2-ylamino)propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol (PubChem CID 23467799) has the molecular formula C29H47N3O4 and a molecular weight of 501.71 g/mol. Its IUPAC name is 3-[3-(1,3-dihydroxypropan-2-ylamino)propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol.
| Compound Name | 3-[3-(1,3-dihydroxypropan-2-ylamino)propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 23467799 |
| Molecular Formula | C29H47N3O4 |
| Molecular Weight | 501.71 g/mol |
| Exact Mass | 501.36 |
| IUPAC Name | 3-[3-(1,3-dihydroxypropan-2-ylamino)propyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol |
| SMILES | OCC(O)CN(CCCNC(CO)CO)CCCNC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C29H47N3O4/c33-22-28(23-34)31-18-8-20-32(21-29(36)24-35)19-7-17-30-27(15-13-25-9-3-1-4-10-25)16-14-26-11-5-2-6-12-26/h1-6,9-12,27-31,33-36H,7-8,13-24H2 |
| InChIKey | DVNUNVZVVXVCQR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|