C26H41N3O2 — CID 23467813
3-[3-aminopropyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol (PubChem CID 23467813) has the molecular formula C26H41N3O2 and a molecular weight of 427.63 g/mol. Its IUPAC name is 3-[3-aminopropyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol.
| Compound Name | 3-[3-aminopropyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 23467813 |
| Molecular Formula | C26H41N3O2 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.32 |
| IUPAC Name | 3-[3-aminopropyl-[3-(1,5-diphenylpentan-3-ylamino)propyl]amino]propane-1,2-diol |
| SMILES | NCCCN(CCCNC(CCc1ccccc1)CCc1ccccc1)CC(O)CO |
| InChI | InChI=1S/C26H41N3O2/c27-17-7-19-29(21-26(31)22-30)20-8-18-28-25(15-13-23-9-3-1-4-10-23)16-14-24-11-5-2-6-12-24/h1-6,9-12,25-26,28,30-31H,7-8,13-22,27H2 |
| InChIKey | AXAUSWGITDIDRL-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|