About butan-2-ylcyclohexane
butan-2-ylcyclohexane (PubChem CID 23468) has the molecular formula C10H20
and a molecular weight of 140.27 g/mol. Its IUPAC name is butan-2-ylcyclohexane.
Molecular Properties
| Compound Name | butan-2-ylcyclohexane |
| PubChem CID | 23468 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | butan-2-ylcyclohexane |
| SMILES | CCC(C)C1CCCCC1 |
| InChI | InChI=1S/C10H20/c1-3-9(2)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | QTYARKOMFKRPSY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylcyclohexane?
The IUPAC name of butan-2-ylcyclohexane (CID 23468) is butan-2-ylcyclohexane.
What is the SMILES notation for butan-2-ylcyclohexane?
The canonical SMILES for butan-2-ylcyclohexane is CCC(C)C1CCCCC1.
What is the InChIKey of butan-2-ylcyclohexane?
The InChIKey is QTYARKOMFKRPSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20/c1-3-9(2)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of butan-2-ylcyclohexane?
butan-2-ylcyclohexane has a molecular weight of 140.27 g/mol, XLogP of 3.61, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylcyclohexane is sourced from PubChem (CID 23468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).