C12H28N2 — CID 23468038
3-N,3-N,4-N,4-N,3,4-hexamethylhexane-3,4-diamine (PubChem CID 23468038) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 3-N,3-N,4-N,4-N,3,4-hexamethylhexane-3,4-diamine.
| Compound Name | 3-N,3-N,4-N,4-N,3,4-hexamethylhexane-3,4-diamine |
|---|---|
| PubChem CID | 23468038 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | 3-N,3-N,4-N,4-N,3,4-hexamethylhexane-3,4-diamine |
| SMILES | CCC(C)(N(C)C)C(C)(CC)N(C)C |
| InChI | InChI=1S/C12H28N2/c1-9-11(3,13(5)6)12(4,10-2)14(7)8/h9-10H2,1-8H3 |
| InChIKey | SKZWUTBSVDHKPY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |