C23H32F3NO4S — CID 23468088
ethyl 4-[3-[4-oxo-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-2-yl]propyl]benzoate (PubChem CID 23468088) has the molecular formula C23H32F3NO4S and a molecular weight of 475.57 g/mol. Its IUPAC name is ethyl 4-[3-[4-oxo-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-2-yl]propyl]benzoate.
| Compound Name | ethyl 4-[3-[4-oxo-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-2-yl]propyl]benzoate |
|---|---|
| PubChem CID | 23468088 |
| Molecular Formula | C23H32F3NO4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | ethyl 4-[3-[4-oxo-3-(8,8,8-trifluoro-3-hydroxyoctyl)-1,3-thiazolidin-2-yl]propyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CCCC2SCC(=O)N2CCC(O)CCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H32F3NO4S/c1-2-31-22(30)18-11-9-17(10-12-18)6-5-8-21-27(20(29)16-32-21)15-13-19(28)7-3-4-14-23(24,25)26/h9-12,19,21,28H,2-8,13-16H2,1H3 |
| InChIKey | RRGDLLPBMILBST-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|