C14H22N2O3S — CID 23468216
5-acetyl-1,3-dibutyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 23468216) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-acetyl-1,3-dibutyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-acetyl-1,3-dibutyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 23468216 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 5-acetyl-1,3-dibutyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCCCN1C(=O)C(C(C)=O)C(=O)N(CCCC)C1=S |
| InChI | InChI=1S/C14H22N2O3S/c1-4-6-8-15-12(18)11(10(3)17)13(19)16(14(15)20)9-7-5-2/h11H,4-9H2,1-3H3 |
| InChIKey | LDSYRBLHZPDGKZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|