C14H14F3N3O2 — CID 2346850
2-cyano-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 2346850) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is 2-cyano-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-cyano-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 2346850 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-cyano-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | N#CCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1 |
| InChI | InChI=1S/C14H14F3N3O2/c15-14(16,17)10-1-2-12(20-5-7-22-8-6-20)11(9-10)19-13(21)3-4-18/h1-2,9H,3,5-8H2,(H,19,21) |
| InChIKey | GKMTYKYTFPNVJJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |