C24H30O8 — CID 23468776
diethyl 4-hydroxy-2-(7-methoxy-2,3-dimethyl-1-benzofuran-5-yl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate (PubChem CID 23468776) has the molecular formula C24H30O8 and a molecular weight of 446.50 g/mol. Its IUPAC name is diethyl 4-hydroxy-2-(7-methoxy-2,3-dimethyl-1-benzofuran-5-yl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate.
| Compound Name | diethyl 4-hydroxy-2-(7-methoxy-2,3-dimethyl-1-benzofuran-5-yl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23468776 |
| Molecular Formula | C24H30O8 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | diethyl 4-hydroxy-2-(7-methoxy-2,3-dimethyl-1-benzofuran-5-yl)-4-methyl-6-oxocyclohexane-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)CC(C)(O)C(C(=O)OCC)C1c1cc(OC)c2oc(C)c(C)c2c1 |
| InChI | InChI=1S/C24H30O8/c1-7-30-22(26)19-16(25)11-24(5,28)20(23(27)31-8-2)18(19)14-9-15-12(3)13(4)32-21(15)17(10-14)29-6/h9-10,18-20,28H,7-8,11H2,1-6H3 |
| InChIKey | OOAMAVLVEPIJRF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|