About N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide (PubChem CID 23469548) has the molecular formula C13H14Cl2N2O2S
and a molecular weight of 333.24 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide.
Molecular Properties
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide |
| PubChem CID | 23469548 |
| Molecular Formula | C13H14Cl2N2O2S |
| Molecular Weight | 333.24 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide |
| SMILES | N/C(=N/S(=O)(=O)/C=C/c1ccc(Cl)c(Cl)c1)C1CCC1 |
| InChI | InChI=1S/C13H14Cl2N2O2S/c14-11-5-4-9(8-12(11)15)6-7-20(18,19)17-13(16)10-2-1-3-10/h4-8,10H,1-3H2,(H2,16,17)/b7-6+ |
| InChIKey | GZVWRTCNOYTOEX-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide?
The IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide (CID 23469548) is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide.
What is the SMILES notation for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide?
The canonical SMILES for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide is N/C(=N/S(=O)(=O)/C=C/c1ccc(Cl)c(Cl)c1)C1CCC1.
What is the InChIKey of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide?
The InChIKey is GZVWRTCNOYTOEX-VOTSOKGWSA-N. The full InChI is InChI=1S/C13H14Cl2N2O2S/c14-11-5-4-9(8-12(11)15)6-7-20(18,19)17-13(16)10-2-1-3-10/h4-8,10H,1-3H2,(H2,16,17)/b7-6+.
What are the key properties of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide?
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide has a molecular weight of 333.24 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]sulfonylcyclobutanecarboximidamide is sourced from PubChem (CID 23469548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).