About N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride (PubChem CID 23469591) has the molecular formula C10H11Cl3N2
and a molecular weight of 265.57 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride |
| PubChem CID | 23469591 |
| Molecular Formula | C10H11Cl3N2 |
| Molecular Weight | 265.57 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride |
| SMILES | C/C(N)=N\C=C\c1ccc(Cl)c(Cl)c1.Cl |
| InChI | InChI=1S/C10H10Cl2N2.ClH/c1-7(13)14-5-4-8-2-3-9(11)10(12)6-8;/h2-6H,1H3,(H2,13,14);1H/b5-4+; |
| InChIKey | WKVITXMDLSYBHD-FXRZFVDSSA-N |
| XLogP | 3.76 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.57 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride?
The IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride (CID 23469591) is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride.
What is the SMILES notation for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride?
The canonical SMILES for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride is C/C(N)=N\C=C\c1ccc(Cl)c(Cl)c1.Cl.
What is the InChIKey of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride?
The InChIKey is WKVITXMDLSYBHD-FXRZFVDSSA-N. The full InChI is InChI=1S/C10H10Cl2N2.ClH/c1-7(13)14-5-4-8-2-3-9(11)10(12)6-8;/h2-6H,1H3,(H2,13,14);1H/b5-4+;.
What are the key properties of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride?
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride has a molecular weight of 265.57 g/mol, XLogP of 3.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]ethanimidamide;hydrochloride is sourced from PubChem (CID 23469591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).