About N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide (PubChem CID 23469654) has the molecular formula C15H18Cl2N2
and a molecular weight of 297.23 g/mol. Its IUPAC name is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide.
Molecular Properties
| Compound Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide |
| PubChem CID | 23469654 |
| Molecular Formula | C15H18Cl2N2 |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide |
| SMILES | N/C(=N\C=C\c1ccc(Cl)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C15H18Cl2N2/c16-13-7-6-11(10-14(13)17)8-9-19-15(18)12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H2,18,19)/b9-8+ |
| InChIKey | YAINCHKNPMDBLI-CMDGGOBGSA-N |
| XLogP | 4.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide?
The IUPAC name of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide (CID 23469654) is N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide.
What is the SMILES notation for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide?
The canonical SMILES for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide is N/C(=N\C=C\c1ccc(Cl)c(Cl)c1)C1CCCCC1.
What is the InChIKey of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide?
The InChIKey is YAINCHKNPMDBLI-CMDGGOBGSA-N. The full InChI is InChI=1S/C15H18Cl2N2/c16-13-7-6-11(10-14(13)17)8-9-19-15(18)12-4-2-1-3-5-12/h6-10,12H,1-5H2,(H2,18,19)/b9-8+.
What are the key properties of N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide?
N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide has a molecular weight of 297.23 g/mol, XLogP of 4.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(E)-2-(3,4-dichlorophenyl)ethenyl]cyclohexanecarboximidamide is sourced from PubChem (CID 23469654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).