C25H32N4 — CID 23470284
N,N-dimethyl-8-[(4-phenylpiperazin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 23470284) has the molecular formula C25H32N4 and a molecular weight of 388.56 g/mol. Its IUPAC name is N,N-dimethyl-8-[(4-phenylpiperazin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | N,N-dimethyl-8-[(4-phenylpiperazin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 23470284 |
| Molecular Formula | C25H32N4 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | N,N-dimethyl-8-[(4-phenylpiperazin-1-yl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CN(C)C1CCc2[nH]c3c(CN4CCN(c5ccccc5)CC4)cccc3c2C1 |
| InChI | InChI=1S/C25H32N4/c1-27(2)21-11-12-24-23(17-21)22-10-6-7-19(25(22)26-24)18-28-13-15-29(16-14-28)20-8-4-3-5-9-20/h3-10,21,26H,11-18H2,1-2H3 |
| InChIKey | FUHDCWQFZWSAEM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 25.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|