C23H26F2N2O3 — CID 23470307
6,8-difluoro-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 23470307) has the molecular formula C23H26F2N2O3 and a molecular weight of 416.47 g/mol. Its IUPAC name is 6,8-difluoro-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | 6,8-difluoro-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 23470307 |
| Molecular Formula | C23H26F2N2O3 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 6,8-difluoro-N-methyl-N-[(3,4,5-trimethoxyphenyl)methyl]-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | COc1cc(CN(C)C2CCc3[nH]c4c(F)cc(F)cc4c3C2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26F2N2O3/c1-27(12-13-7-20(28-2)23(30-4)21(8-13)29-3)15-5-6-19-16(11-15)17-9-14(24)10-18(25)22(17)26-19/h7-10,15,26H,5-6,11-12H2,1-4H3 |
| InChIKey | VZHKYJLCOGMAAN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|