C20H18ClF2N3O2 — CID 23470527
N-[(2-chloro-4-nitrophenyl)methyl]-6,8-difluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine (PubChem CID 23470527) has the molecular formula C20H18ClF2N3O2 and a molecular weight of 405.83 g/mol. Its IUPAC name is N-[(2-chloro-4-nitrophenyl)methyl]-6,8-difluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine.
| Compound Name | N-[(2-chloro-4-nitrophenyl)methyl]-6,8-difluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
|---|---|
| PubChem CID | 23470527 |
| Molecular Formula | C20H18ClF2N3O2 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[(2-chloro-4-nitrophenyl)methyl]-6,8-difluoro-N-methyl-2,3,4,9-tetrahydro-1H-carbazol-3-amine |
| SMILES | CN(Cc1ccc([N+](=O)[O-])cc1Cl)C1CCc2[nH]c3c(F)cc(F)cc3c2C1 |
| InChI | InChI=1S/C20H18ClF2N3O2/c1-25(10-11-2-3-14(26(27)28)9-17(11)21)13-4-5-19-15(8-13)16-6-12(22)7-18(23)20(16)24-19/h2-3,6-7,9,13,24H,4-5,8,10H2,1H3 |
| InChIKey | OEKIZXYUTNDSHE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|