About 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline
4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline (PubChem CID 23470548) has the molecular formula C26H28N2O3S
and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline |
| PubChem CID | 23470548 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline |
| SMILES | COc1ccc(S(C)(=O)=O)c(-c2c(C)n(C)c3ccccc23)c1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-17-24(20-9-7-8-10-21(20)28(17)4)26-23(32(6,29)30)16-15-22(31-5)25(26)18-11-13-19(14-12-18)27(2)3/h7-16H,1-6H3 |
| InChIKey | IRNVMZOBSIIRRU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline?
The IUPAC name of 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline (CID 23470548) is 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline is COc1ccc(S(C)(=O)=O)c(-c2c(C)n(C)c3ccccc23)c1-c1ccc(N(C)C)cc1.
What is the InChIKey of 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline?
The InChIKey is IRNVMZOBSIIRRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28N2O3S/c1-17-24(20-9-7-8-10-21(20)28(17)4)26-23(32(6,29)30)16-15-22(31-5)25(26)18-11-13-19(14-12-18)27(2)3/h7-16H,1-6H3.
What are the key properties of 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline?
4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline has a molecular weight of 448.59 g/mol, XLogP of 5.30, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,2-dimethylindol-3-yl)-6-methoxy-3-methylsulfonylphenyl]-N,N-dimethylaniline is sourced from PubChem (CID 23470548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).