About 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride
2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride (PubChem CID 23470876) has the molecular formula C19H20Cl3N3S
and a molecular weight of 428.82 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride.
Molecular Properties
| Compound Name | 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride |
| PubChem CID | 23470876 |
| Molecular Formula | C19H20Cl3N3S |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(-c2c(CC3NCCS3)cnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H18ClN3S.2ClH/c20-16-8-6-14(7-9-16)19-15(12-18-21-10-11-24-18)13-22-23(19)17-4-2-1-3-5-17;;/h1-9,13,18,21H,10-12H2;2*1H |
| InChIKey | PNICGGBZHJOBRV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride?
The IUPAC name of 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride (CID 23470876) is 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride.
What is the SMILES notation for 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride?
The canonical SMILES for 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride is Cl.Cl.Clc1ccc(-c2c(CC3NCCS3)cnn2-c2ccccc2)cc1.
What is the InChIKey of 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride?
The InChIKey is PNICGGBZHJOBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3S.2ClH/c20-16-8-6-14(7-9-16)19-15(12-18-21-10-11-24-18)13-22-23(19)17-4-2-1-3-5-17;;/h1-9,13,18,21H,10-12H2;2*1H.
What are the key properties of 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride?
2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride has a molecular weight of 428.82 g/mol, XLogP of 5.24, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methyl]-1,3-thiazolidine;dihydrochloride is sourced from PubChem (CID 23470876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).