C16H28N2 — CID 23471344
(5Z,9Z)-3,12-dipropyl-1,2-diazacyclododeca-1,5,9-triene (PubChem CID 23471344) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is (5Z,9Z)-3,12-dipropyl-1,2-diazacyclododeca-1,5,9-triene.
| Compound Name | (5Z,9Z)-3,12-dipropyl-1,2-diazacyclododeca-1,5,9-triene |
|---|---|
| PubChem CID | 23471344 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | (5Z,9Z)-3,12-dipropyl-1,2-diazacyclododeca-1,5,9-triene |
| SMILES | CCCC1C/C=C\CC/C=C\CC(CCC)/N=N/1 |
| InChI | InChI=1S/C16H28N2/c1-3-11-15-13-9-7-5-6-8-10-14-16(12-4-2)18-17-15/h7-10,15-16H,3-6,11-14H2,1-2H3/b9-7-,10-8-,18-17+ |
| InChIKey | FLGIBBNBFWNAJN-GKFZLXSNSA-N |
| XLogP | 5.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|