C20H22N8 — CID 23471368
2-methyl-1-[(E)-[10-[(E)-[(N'-methylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine (PubChem CID 23471368) has the molecular formula C20H22N8 and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-methyl-1-[(E)-[10-[(E)-[(N'-methylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine.
| Compound Name | 2-methyl-1-[(E)-[10-[(E)-[(N'-methylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 23471368 |
| Molecular Formula | C20H22N8 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-methyl-1-[(E)-[10-[(E)-[(N'-methylcarbamimidoyl)hydrazinylidene]methyl]anthracen-9-yl]methylideneamino]guanidine |
| SMILES | C/N=C(\N)N/N=C/c1c2ccccc2c(/C=N/N/C(N)=N/C)c2ccccc12 |
| InChI | InChI=1S/C20H22N8/c1-23-19(21)27-25-11-17-13-7-3-5-9-15(13)18(12-26-28-20(22)24-2)16-10-6-4-8-14(16)17/h3-12H,1-2H3,(H3,21,23,27)(H3,22,24,28)/b25-11+,26-12+ |
| InChIKey | FEYWTFUTTKGNEU-KOZSXFMUSA-N |
| XLogP | 1.73 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|