About 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide
1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide (PubChem CID 23471408) has the molecular formula C7H19IN4
and a molecular weight of 286.16 g/mol. Its IUPAC name is 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide.
Molecular Properties
| Compound Name | 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide |
| PubChem CID | 23471408 |
| Molecular Formula | C7H19IN4 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide |
| SMILES | CC(C)/N=C(\NN)NC(C)C.I |
| InChI | InChI=1S/C7H18N4.HI/c1-5(2)9-7(11-8)10-6(3)4;/h5-6H,8H2,1-4H3,(H2,9,10,11);1H |
| InChIKey | OTVQWUVFAJCZSF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide?
The IUPAC name of 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide (CID 23471408) is 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide.
What is the SMILES notation for 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide?
The canonical SMILES for 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide is CC(C)/N=C(\NN)NC(C)C.I.
What is the InChIKey of 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide?
The InChIKey is OTVQWUVFAJCZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N4.HI/c1-5(2)9-7(11-8)10-6(3)4;/h5-6H,8H2,1-4H3,(H2,9,10,11);1H.
What are the key properties of 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide?
1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide has a molecular weight of 286.16 g/mol, XLogP of 0.83, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,3-di(propan-2-yl)guanidine;hydroiodide is sourced from PubChem (CID 23471408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).