About 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride
1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride (PubChem CID 23471446) has the molecular formula C18H16Cl2O2
and a molecular weight of 335.23 g/mol. Its IUPAC name is 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride.
Molecular Properties
| Compound Name | 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride |
| PubChem CID | 23471446 |
| Molecular Formula | C18H16Cl2O2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride |
| SMILES | Cc1ccc(C)c2c(C=O)c3ccccc3c(C=O)c12.Cl.Cl |
| InChI | InChI=1S/C18H14O2.2ClH/c1-11-7-8-12(2)18-16(10-20)14-6-4-3-5-13(14)15(9-19)17(11)18;;/h3-10H,1-2H3;2*1H |
| InChIKey | SXCJVHHMOMCOFH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride?
The IUPAC name of 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride (CID 23471446) is 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride.
What is the SMILES notation for 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride?
The canonical SMILES for 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride is Cc1ccc(C)c2c(C=O)c3ccccc3c(C=O)c12.Cl.Cl.
What is the InChIKey of 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride?
The InChIKey is SXCJVHHMOMCOFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O2.2ClH/c1-11-7-8-12(2)18-16(10-20)14-6-4-3-5-13(14)15(9-19)17(11)18;;/h3-10H,1-2H3;2*1H.
What are the key properties of 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride?
1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride has a molecular weight of 335.23 g/mol, XLogP of 5.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylanthracene-9,10-dicarbaldehyde;dihydrochloride is sourced from PubChem (CID 23471446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).