C3H6N4S — CID 23471495
5-(aminomethyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 23471495) has the molecular formula C3H6N4S and a molecular weight of 130.18 g/mol. Its IUPAC name is 5-(aminomethyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(aminomethyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 23471495 |
| Molecular Formula | C3H6N4S |
| Molecular Weight | 130.18 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 5-(aminomethyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | NCc1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C3H6N4S/c4-1-2-5-3(8)7-6-2/h1,4H2,(H2,5,6,7,8) |
| InChIKey | HIWVKUUJESKXGU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 70.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.18 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|