About N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide
N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide (PubChem CID 2347440) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide |
| PubChem CID | 2347440 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2ccc(-c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C22H21NO3/c1-25-20-13-8-16(14-21(20)26-2)15-23-22(24)19-11-9-18(10-12-19)17-6-4-3-5-7-17/h3-14H,15H2,1-2H3,(H,23,24) |
| InChIKey | ZJVKYNGLIPEWKP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide?
The IUPAC name of N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide (CID 2347440) is N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide.
What is the SMILES notation for N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide?
The canonical SMILES for N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide is COc1ccc(CNC(=O)c2ccc(-c3ccccc3)cc2)cc1OC.
What is the InChIKey of N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide?
The InChIKey is ZJVKYNGLIPEWKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c1-25-20-13-8-16(14-21(20)26-2)15-23-22(24)19-11-9-18(10-12-19)17-6-4-3-5-7-17/h3-14H,15H2,1-2H3,(H,23,24).
What are the key properties of N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide?
N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide has a molecular weight of 347.41 g/mol, XLogP of 4.30, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethoxyphenyl)methyl]-4-phenylbenzamide is sourced from PubChem (CID 2347440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).