C22H24N4O3 — CID 23474431
3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]-1H-quinoxalin-2-one (PubChem CID 23474431) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]-1H-quinoxalin-2-one.
| Compound Name | 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 23474431 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]-3-oxopropyl]-1H-quinoxalin-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)CCc3nc4ccccc4[nH]c3=O)CC2)cc1 |
| InChI | InChI=1S/C22H24N4O3/c1-29-17-8-6-16(7-9-17)25-12-14-26(15-13-25)21(27)11-10-20-22(28)24-19-5-3-2-4-18(19)23-20/h2-9H,10-15H2,1H3,(H,24,28) |
| InChIKey | UVOCFQZOBSXHQR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|