C17H12N4O3S — CID 23474592
N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 23474592) has the molecular formula C17H12N4O3S and a molecular weight of 352.38 g/mol. Its IUPAC name is N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 23474592 |
| Molecular Formula | C17H12N4O3S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-(3-cyano-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | N#Cc1c(NC(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)sc2c1CCC2 |
| InChI | InChI=1S/C17H12N4O3S/c18-7-10-9-2-1-3-13(9)25-17(10)21-14(22)8-4-5-11-12(6-8)20-16(24)15(23)19-11/h4-6H,1-3H2,(H,19,23)(H,20,24)(H,21,22) |
| InChIKey | ONEZJUZYWLBVCC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|