C18H16Br2N2O — CID 23474755
N-(2,4-dibromophenyl)-N,2,3-trimethyl-1H-indole-5-carboxamide (PubChem CID 23474755) has the molecular formula C18H16Br2N2O and a molecular weight of 436.15 g/mol. Its IUPAC name is N-(2,4-dibromophenyl)-N,2,3-trimethyl-1H-indole-5-carboxamide.
| Compound Name | N-(2,4-dibromophenyl)-N,2,3-trimethyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 23474755 |
| Molecular Formula | C18H16Br2N2O |
| Molecular Weight | 436.15 g/mol |
| Exact Mass | 433.96 |
| IUPAC Name | N-(2,4-dibromophenyl)-N,2,3-trimethyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)N(C)c3ccc(Br)cc3Br)cc2c1C |
| InChI | InChI=1S/C18H16Br2N2O/c1-10-11(2)21-16-6-4-12(8-14(10)16)18(23)22(3)17-7-5-13(19)9-15(17)20/h4-9,21H,1-3H3 |
| InChIKey | QRDVJXQYJSVYIX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.15 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|