C22H22N2O4 — CID 23475454
11-hydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydropyrido[3,2-c][1]benzazepine-5,10-dione (PubChem CID 23475454) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is 11-hydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydropyrido[3,2-c][1]benzazepine-5,10-dione.
| Compound Name | 11-hydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydropyrido[3,2-c][1]benzazepine-5,10-dione |
|---|---|
| PubChem CID | 23475454 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 11-hydroxy-2-(4-methoxyphenyl)-8,8-dimethyl-6,7,9,11-tetrahydropyrido[3,2-c][1]benzazepine-5,10-dione |
| SMILES | COc1ccc(-c2ccc3c(n2)C(O)C2=C(CC(C)(C)CC2=O)NC3=O)cc1 |
| InChI | InChI=1S/C22H22N2O4/c1-22(2)10-16-18(17(25)11-22)20(26)19-14(21(27)24-16)8-9-15(23-19)12-4-6-13(28-3)7-5-12/h4-9,20,26H,10-11H2,1-3H3,(H,24,27) |
| InChIKey | KULKSZWRKIUPLB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |