C24H27N2OS+ — CID 2347584
1-[4-[3-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium-1-yl]phenyl]ethanone (PubChem CID 2347584) has the molecular formula C24H27N2OS+ and a molecular weight of 391.56 g/mol. Its IUPAC name is 1-[4-[3-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[3-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 2347584 |
| Molecular Formula | C24H27N2OS+ |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 1-[4-[3-(4-tert-butylphenyl)-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-4-ium-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-n2cc(-c3ccc(C(C)(C)C)cc3)[n+]3c2SCCC3)cc1 |
| InChI | InChI=1S/C24H27N2OS/c1-17(27)18-8-12-21(13-9-18)26-16-22(25-14-5-15-28-23(25)26)19-6-10-20(11-7-19)24(2,3)4/h6-13,16H,5,14-15H2,1-4H3/q+1 |
| InChIKey | FQWULLSLWZVYRV-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|