C18H16ClN5O2 — CID 23478254
6-N-(2-chlorophenyl)-4-N-ethyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 23478254) has the molecular formula C18H16ClN5O2 and a molecular weight of 369.81 g/mol. Its IUPAC name is 6-N-(2-chlorophenyl)-4-N-ethyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-chlorophenyl)-4-N-ethyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23478254 |
| Molecular Formula | C18H16ClN5O2 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 6-N-(2-chlorophenyl)-4-N-ethyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | CCN(c1ccccc1)c1ncnc(Nc2ccccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16ClN5O2/c1-2-23(13-8-4-3-5-9-13)18-16(24(25)26)17(20-12-21-18)22-15-11-7-6-10-14(15)19/h3-12H,2H2,1H3,(H,20,21,22) |
| InChIKey | YFKLJPFMTCMMKO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|