About N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride
N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride (PubChem CID 23479) has the molecular formula C20H28ClN
and a molecular weight of 317.90 g/mol. Its IUPAC name is N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride.
Molecular Properties
| Compound Name | N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride |
| PubChem CID | 23479 |
| Molecular Formula | C20H28ClN |
| Molecular Weight | 317.90 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride |
| SMILES | CC(CC(c1ccccc1)c1ccccc1)NC(C)(C)C.Cl |
| InChI | InChI=1S/C20H27N.ClH/c1-16(21-20(2,3)4)15-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,16,19,21H,15H2,1-4H3;1H |
| InChIKey | RNGHAJVBYQPLAZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.90 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride?
The IUPAC name of N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride (CID 23479) is N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride.
What is the SMILES notation for N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride?
The canonical SMILES for N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride is CC(CC(c1ccccc1)c1ccccc1)NC(C)(C)C.Cl.
What is the InChIKey of N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride?
The InChIKey is RNGHAJVBYQPLAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27N.ClH/c1-16(21-20(2,3)4)15-19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,16,19,21H,15H2,1-4H3;1H.
What are the key properties of N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride?
N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride has a molecular weight of 317.90 g/mol, XLogP of 5.41, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-4,4-diphenylbutan-2-amine;hydrochloride is sourced from PubChem (CID 23479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).