About (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate
(2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate (PubChem CID 2347995) has the molecular formula C17H23NO6
and a molecular weight of 337.37 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate.
Molecular Properties
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate |
| PubChem CID | 2347995 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate |
| SMILES | CCOc1ccc(C(=O)OCC(=O)N2CCOCC2)cc1OCC |
| InChI | InChI=1S/C17H23NO6/c1-3-22-14-6-5-13(11-15(14)23-4-2)17(20)24-12-16(19)18-7-9-21-10-8-18/h5-6,11H,3-4,7-10,12H2,1-2H3 |
| InChIKey | KYMVDWMLEZRMEH-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate?
The IUPAC name of (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate (CID 2347995) is (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate.
What is the SMILES notation for (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate?
The canonical SMILES for (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate is CCOc1ccc(C(=O)OCC(=O)N2CCOCC2)cc1OCC.
What is the InChIKey of (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate?
The InChIKey is KYMVDWMLEZRMEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO6/c1-3-22-14-6-5-13(11-15(14)23-4-2)17(20)24-12-16(19)18-7-9-21-10-8-18/h5-6,11H,3-4,7-10,12H2,1-2H3.
What are the key properties of (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate?
(2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate has a molecular weight of 337.37 g/mol, XLogP of 1.50, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-morpholin-4-yl-2-oxoethyl) 3,4-diethoxybenzoate is sourced from PubChem (CID 2347995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).