C18H15F2N5O2 — CID 23482985
4-N-(2,4-difluorophenyl)-6-N-(4-ethylphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23482985) has the molecular formula C18H15F2N5O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-N-(2,4-difluorophenyl)-6-N-(4-ethylphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,4-difluorophenyl)-6-N-(4-ethylphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23482985 |
| Molecular Formula | C18H15F2N5O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-N-(2,4-difluorophenyl)-6-N-(4-ethylphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCc1ccc(Nc2ncnc(Nc3ccc(F)cc3F)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15F2N5O2/c1-2-11-3-6-13(7-4-11)23-17-16(25(26)27)18(22-10-21-17)24-15-8-5-12(19)9-14(15)20/h3-10H,2H2,1H3,(H2,21,22,23,24) |
| InChIKey | YRPNSVUCCMJIIW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|