C18H18N6O2 — CID 23483745
6-N-(2,4-dimethylphenyl)-4-N-(4-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23483745) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 6-N-(2,4-dimethylphenyl)-4-N-(4-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2,4-dimethylphenyl)-4-N-(4-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23483745 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 6-N-(2,4-dimethylphenyl)-4-N-(4-methyl-2-pyridinyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccnc(Nc2ncnc(Nc3ccc(C)cc3C)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N6O2/c1-11-4-5-14(13(3)8-11)22-17-16(24(25)26)18(21-10-20-17)23-15-9-12(2)6-7-19-15/h4-10H,1-3H3,(H2,19,20,21,22,23) |
| InChIKey | ITMFQVMQITYHST-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|