C17H15N3O3S2 — CID 2348696
methyl 3-oxo-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanoate (PubChem CID 2348696) has the molecular formula C17H15N3O3S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is methyl 3-oxo-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanoate.
| Compound Name | methyl 3-oxo-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanoate |
|---|---|
| PubChem CID | 2348696 |
| Molecular Formula | C17H15N3O3S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | methyl 3-oxo-4-[(4-phenyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]butanoate |
| SMILES | COC(=O)CC(=O)CSc1nnc(-c2cccs2)n1-c1ccccc1 |
| InChI | InChI=1S/C17H15N3O3S2/c1-23-15(22)10-13(21)11-25-17-19-18-16(14-8-5-9-24-14)20(17)12-6-3-2-4-7-12/h2-9H,10-11H2,1H3 |
| InChIKey | XFFSGOFSCSIHND-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|