C7H10N4O3 — CID 23486998
6-ethoxy-N-methyl-5-nitropyrimidin-4-amine (PubChem CID 23486998) has the molecular formula C7H10N4O3 and a molecular weight of 198.18 g/mol. Its IUPAC name is 6-ethoxy-N-methyl-5-nitropyrimidin-4-amine.
| Compound Name | 6-ethoxy-N-methyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23486998 |
| Molecular Formula | C7H10N4O3 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 6-ethoxy-N-methyl-5-nitropyrimidin-4-amine |
| SMILES | CCOc1ncnc(NC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C7H10N4O3/c1-3-14-7-5(11(12)13)6(8-2)9-4-10-7/h4H,3H2,1-2H3,(H,8,9,10) |
| InChIKey | NSQVSFFSEVDGIR-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|