About 9H-fluoren-4-amine
9H-fluoren-4-amine (PubChem CID 23488) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 9H-fluoren-4-amine.
Molecular Properties
| Compound Name | 9H-fluoren-4-amine |
| PubChem CID | 23488 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 9H-fluoren-4-amine |
| SMILES | Nc1cccc2c1-c1ccccc1C2 |
| InChI | InChI=1S/C13H11N/c14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7H,8,14H2 |
| InChIKey | NNHRVRJFHLVIIV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-4-amine?
The IUPAC name of 9H-fluoren-4-amine (CID 23488) is 9H-fluoren-4-amine.
What is the SMILES notation for 9H-fluoren-4-amine?
The canonical SMILES for 9H-fluoren-4-amine is Nc1cccc2c1-c1ccccc1C2.
What is the InChIKey of 9H-fluoren-4-amine?
The InChIKey is NNHRVRJFHLVIIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c14-12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7H,8,14H2.
What are the key properties of 9H-fluoren-4-amine?
9H-fluoren-4-amine has a molecular weight of 181.24 g/mol, XLogP of 2.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-4-amine is sourced from PubChem (CID 23488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).