C28H33N5O2 — CID 23488282
N,N-dibenzyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine (PubChem CID 23488282) has the molecular formula C28H33N5O2 and a molecular weight of 471.61 g/mol. Its IUPAC name is N,N-dibenzyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine.
| Compound Name | N,N-dibenzyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23488282 |
| Molecular Formula | C28H33N5O2 |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | N,N-dibenzyl-5-nitro-6-(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)pyrimidin-4-amine |
| SMILES | CC1(C)CC2CC(C)(CN2c2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C28H33N5O2/c1-27(2)14-23-15-28(3,18-27)19-32(23)26-24(33(34)35)25(29-20-30-26)31(16-21-10-6-4-7-11-21)17-22-12-8-5-9-13-22/h4-13,20,23H,14-19H2,1-3H3 |
| InChIKey | WRQHKDSSHMNZJG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|