About ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate
ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate (PubChem CID 2348924) has the molecular formula C17H17NO3S
and a molecular weight of 315.39 g/mol. Its IUPAC name is ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate.
Molecular Properties
| Compound Name | ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate |
| PubChem CID | 2348924 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc3c(s2)CCC3)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-2-21-17(20)11-6-8-13(9-7-11)18-16(19)15-10-12-4-3-5-14(12)22-15/h6-10H,2-5H2,1H3,(H,18,19) |
| InChIKey | ZVJQBRXUVCZMRE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate?
The IUPAC name of ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate (CID 2348924) is ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate.
What is the SMILES notation for ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate?
The canonical SMILES for ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate is CCOC(=O)c1ccc(NC(=O)c2cc3c(s2)CCC3)cc1.
What is the InChIKey of ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate?
The InChIKey is ZVJQBRXUVCZMRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO3S/c1-2-21-17(20)11-6-8-13(9-7-11)18-16(19)15-10-12-4-3-5-14(12)22-15/h6-10H,2-5H2,1H3,(H,18,19).
What are the key properties of ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate?
ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate has a molecular weight of 315.39 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(5,6-dihydro-4H-cyclopenta[b]thiophene-2-carbonylamino)benzoate is sourced from PubChem (CID 2348924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).