About [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone (PubChem CID 2349433) has the molecular formula C20H18ClN3O4S
and a molecular weight of 431.90 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone.
Molecular Properties
| Compound Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone |
| PubChem CID | 2349433 |
| Molecular Formula | C20H18ClN3O4S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone |
| SMILES | O=C(c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H18ClN3O4S/c21-16-8-4-15(5-9-16)19-22-23-20(28-19)18(25)14-6-10-17(11-7-14)29(26,27)24-12-2-1-3-13-24/h4-11H,1-3,12-13H2 |
| InChIKey | NFSONIZEOOZGHR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone?
The IUPAC name of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone (CID 2349433) is [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone.
What is the SMILES notation for [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone?
The canonical SMILES for [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone is O=C(c1ccc(S(=O)(=O)N2CCCCC2)cc1)c1nnc(-c2ccc(Cl)cc2)o1.
What is the InChIKey of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone?
The InChIKey is NFSONIZEOOZGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O4S/c21-16-8-4-15(5-9-16)19-22-23-20(28-19)18(25)14-6-10-17(11-7-14)29(26,27)24-12-2-1-3-13-24/h4-11H,1-3,12-13H2.
What are the key properties of [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone?
[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone has a molecular weight of 431.90 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]-(4-piperidin-1-ylsulfonylphenyl)methanone is sourced from PubChem (CID 2349433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).