About pyrazine-2,6-dicarbaldehyde
pyrazine-2,6-dicarbaldehyde (PubChem CID 23496663) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is pyrazine-2,6-dicarbaldehyde.
Molecular Properties
| Compound Name | pyrazine-2,6-dicarbaldehyde |
| PubChem CID | 23496663 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | pyrazine-2,6-dicarbaldehyde |
| SMILES | O=Cc1cncc(C=O)n1 |
| InChI | InChI=1S/C6H4N2O2/c9-3-5-1-7-2-6(4-10)8-5/h1-4H |
| InChIKey | IKTULDHSBKTAJU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze pyrazine-2,6-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazine-2,6-dicarbaldehyde?
The IUPAC name of pyrazine-2,6-dicarbaldehyde (CID 23496663) is pyrazine-2,6-dicarbaldehyde.
What is the SMILES notation for pyrazine-2,6-dicarbaldehyde?
The canonical SMILES for pyrazine-2,6-dicarbaldehyde is O=Cc1cncc(C=O)n1.
What is the InChIKey of pyrazine-2,6-dicarbaldehyde?
The InChIKey is IKTULDHSBKTAJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c9-3-5-1-7-2-6(4-10)8-5/h1-4H.
What are the key properties of pyrazine-2,6-dicarbaldehyde?
pyrazine-2,6-dicarbaldehyde has a molecular weight of 136.11 g/mol, XLogP of 0.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazine-2,6-dicarbaldehyde is sourced from PubChem (CID 23496663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).