C19H19F13O3S — CID 23497057
7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl 4-methylbenzenesulfonate (PubChem CID 23497057) has the molecular formula C19H19F13O3S and a molecular weight of 574.40 g/mol. Its IUPAC name is 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl 4-methylbenzenesulfonate.
| Compound Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23497057 |
| Molecular Formula | C19H19F13O3S |
| Molecular Weight | 574.40 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H19F13O3S/c1-12-6-8-13(9-7-12)36(33,34)35-11-5-3-2-4-10-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h6-9H,2-5,10-11H2,1H3 |
| InChIKey | QQZCKFYPLAMXLR-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.40 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|